ChemNet > CAS > 39827-11-7 Benzo[b]thiophene-2-carbonyl chloride
39827-11-7 Benzo[b]thiophene-2-carbonyl chloride
| Название продукта |
Benzo[b]thiophene-2-carbonyl chloride |
| Английское название |
Benzo[b]thiophene-2-carbonyl chloride; Thianaphthene-2-carbonyl chloride; 1-benzothiophene-2-carbonyl chloride |
| Молекулярная формула |
C9H5ClOS |
| Молекулярный вес |
196.6534 |
| InChI |
InChI=1/C9H5ClOS/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H |
| Регистрационный номер CAS |
39827-11-7 |
| Молекулярная структура |
![39827-11-7 Benzo[b]thiophene-2-carbonyl chloride](https://images-a.chemnet.com/suppliers/chembase/636/175636.gif)
|
| Плотность |
1.41g/cm3 |
| Температура плавления |
85℃ |
| Точка кипения |
309.5°C at 760 mmHg |
| Показатель преломления |
1.68 |
| Температура вспышки |
141°C |
| Давление пара |
0.000636mmHg at 25°C |
| Символы опасности |
 C:Corrosive;
|
| Риск коды |
R34:Causes burns.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
